About 5-amino-1-propan-2-yl-N'-[(Z)-prop-1-enyl]imidazole-4-carboximidamide
5-amino-1-propan-2-yl-N'-[(Z)-prop-1-enyl]imidazole-4-carboximidamide (PubChem CID 126723593) has the molecular formula C10H17N5
and a molecular weight of 207.28 g/mol. Its IUPAC name is 5-amino-1-propan-2-yl-N'-[(Z)-prop-1-enyl]imidazole-4-carboximidamide.
Molecular Properties
| Compound Name | 5-amino-1-propan-2-yl-N'-[(Z)-prop-1-enyl]imidazole-4-carboximidamide |
| PubChem CID | 126723593 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 5-amino-1-propan-2-yl-N'-[(Z)-prop-1-enyl]imidazole-4-carboximidamide |
| SMILES | C/C=C\N=C(/N)c1ncn(C(C)C)c1N |
| InChI | InChI=1S/C10H17N5/c1-4-5-13-9(11)8-10(12)15(6-14-8)7(2)3/h4-7H,12H2,1-3H3,(H2,11,13)/b5-4- |
| InChIKey | KQUPLWKNWGXXNZ-PLNGDYQASA-N |
| XLogP | 1.29 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1-propan-2-yl-N'-[(Z)-prop-1-enyl]imidazole-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-propan-2-yl-N'-[(Z)-prop-1-enyl]imidazole-4-carboximidamide?
The IUPAC name of 5-amino-1-propan-2-yl-N'-[(Z)-prop-1-enyl]imidazole-4-carboximidamide (CID 126723593) is 5-amino-1-propan-2-yl-N'-[(Z)-prop-1-enyl]imidazole-4-carboximidamide.
What is the SMILES notation for 5-amino-1-propan-2-yl-N'-[(Z)-prop-1-enyl]imidazole-4-carboximidamide?
The canonical SMILES for 5-amino-1-propan-2-yl-N'-[(Z)-prop-1-enyl]imidazole-4-carboximidamide is C/C=C\N=C(/N)c1ncn(C(C)C)c1N.
What is the InChIKey of 5-amino-1-propan-2-yl-N'-[(Z)-prop-1-enyl]imidazole-4-carboximidamide?
The InChIKey is KQUPLWKNWGXXNZ-PLNGDYQASA-N. The full InChI is InChI=1S/C10H17N5/c1-4-5-13-9(11)8-10(12)15(6-14-8)7(2)3/h4-7H,12H2,1-3H3,(H2,11,13)/b5-4-.
What are the key properties of 5-amino-1-propan-2-yl-N'-[(Z)-prop-1-enyl]imidazole-4-carboximidamide?
5-amino-1-propan-2-yl-N'-[(Z)-prop-1-enyl]imidazole-4-carboximidamide has a molecular weight of 207.28 g/mol, XLogP of 1.29, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-propan-2-yl-N'-[(Z)-prop-1-enyl]imidazole-4-carboximidamide is sourced from PubChem (CID 126723593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).