C19H26F2O6S2 — CID 126723763
1-(benzenesulfonyl)-1,1-difluoro-3-sulfanyloxy-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]propan-2-ol (PubChem CID 126723763) has the molecular formula C19H26F2O6S2 and a molecular weight of 452.54 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-1,1-difluoro-3-sulfanyloxy-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]propan-2-ol.
| Compound Name | 1-(benzenesulfonyl)-1,1-difluoro-3-sulfanyloxy-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 126723763 |
| Molecular Formula | C19H26F2O6S2 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 1-(benzenesulfonyl)-1,1-difluoro-3-sulfanyloxy-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]propan-2-ol |
| SMILES | CC(C)=C[C@]1(C)OC(C)(C)O[C@@H]1C(O)(COS)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H26F2O6S2/c1-13(2)11-17(5)15(26-16(3,4)27-17)18(22,12-25-28)19(20,21)29(23,24)14-9-7-6-8-10-14/h6-11,15,22,28H,12H2,1-5H3/t15-,17-,18?/m0/s1 |
| InChIKey | XCIOOYQEPSWBCY-LUIZSJORSA-N |
| XLogP | 3.52 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|