C13H15NS — CID 126724065
3,4,5,6-tetramethyl-1H-quinoline-2-thione (PubChem CID 126724065) has the molecular formula C13H15NS and a molecular weight of 217.34 g/mol. Its IUPAC name is 3,4,5,6-tetramethyl-1H-quinoline-2-thione.
| Compound Name | 3,4,5,6-tetramethyl-1H-quinoline-2-thione |
|---|---|
| PubChem CID | 126724065 |
| Molecular Formula | C13H15NS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 3,4,5,6-tetramethyl-1H-quinoline-2-thione |
| SMILES | Cc1ccc2[nH]c(=S)c(C)c(C)c2c1C |
| InChI | InChI=1S/C13H15NS/c1-7-5-6-11-12(8(7)2)9(3)10(4)13(15)14-11/h5-6H,1-4H3,(H,14,15) |
| InChIKey | VLLWMNAAEXXVBC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|