C29H40N4O2S — CID 126724752
(1R,7R)-4-[[2-[[4-(2-methylsulfanylbenzenecarboximidoyl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 126724752) has the molecular formula C29H40N4O2S and a molecular weight of 508.73 g/mol. Its IUPAC name is (1R,7R)-4-[[2-[[4-(2-methylsulfanylbenzenecarboximidoyl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,7R)-4-[[2-[[4-(2-methylsulfanylbenzenecarboximidoyl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 126724752 |
| Molecular Formula | C29H40N4O2S |
| Molecular Weight | 508.73 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | (1R,7R)-4-[[2-[[4-(2-methylsulfanylbenzenecarboximidoyl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | [H]/N=C(/c1ccccc1SC)N1CCN(CC2CCCCC2CN2C(=O)C3C(C2=O)[C@@H]2CC[C@@H]3C2)CC1 |
| InChI | InChI=1S/C29H40N4O2S/c1-36-24-9-5-4-8-23(24)27(30)32-14-12-31(13-15-32)17-21-6-2-3-7-22(21)18-33-28(34)25-19-10-11-20(16-19)26(25)29(33)35/h4-5,8-9,19-22,25-26,30H,2-3,6-7,10-18H2,1H3/b30-27-/t19-,20-,21?,22?,25?,26?/m1/s1 |
| InChIKey | BXQPFGHDDQZOTH-RZSWBKCKSA-N |
| XLogP | 4.19 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.73 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|