About 2,7-dibenzyl-1-azacycloocta-7,8-diene
2,7-dibenzyl-1-azacycloocta-7,8-diene (PubChem CID 12672486) has the molecular formula C21H23N
and a molecular weight of 289.42 g/mol. Its IUPAC name is 2,7-dibenzyl-1-azacycloocta-7,8-diene.
Molecular Properties
| Compound Name | 2,7-dibenzyl-1-azacycloocta-7,8-diene |
| PubChem CID | 12672486 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2,7-dibenzyl-1-azacycloocta-7,8-diene |
| SMILES | C1=NC(Cc2ccccc2)CCCCC=1Cc1ccccc1 |
| InChI | InChI=1S/C21H23N/c1-3-9-18(10-4-1)15-20-13-7-8-14-21(22-17-20)16-19-11-5-2-6-12-19/h1-6,9-12,21H,7-8,13-16H2 |
| InChIKey | TXKVHFNNXPMGJO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,7-dibenzyl-1-azacycloocta-7,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dibenzyl-1-azacycloocta-7,8-diene?
The IUPAC name of 2,7-dibenzyl-1-azacycloocta-7,8-diene (CID 12672486) is 2,7-dibenzyl-1-azacycloocta-7,8-diene.
What is the SMILES notation for 2,7-dibenzyl-1-azacycloocta-7,8-diene?
The canonical SMILES for 2,7-dibenzyl-1-azacycloocta-7,8-diene is C1=NC(Cc2ccccc2)CCCCC=1Cc1ccccc1.
What is the InChIKey of 2,7-dibenzyl-1-azacycloocta-7,8-diene?
The InChIKey is TXKVHFNNXPMGJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N/c1-3-9-18(10-4-1)15-20-13-7-8-14-21(22-17-20)16-19-11-5-2-6-12-19/h1-6,9-12,21H,7-8,13-16H2.
What are the key properties of 2,7-dibenzyl-1-azacycloocta-7,8-diene?
2,7-dibenzyl-1-azacycloocta-7,8-diene has a molecular weight of 289.42 g/mol, XLogP of 5.01, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dibenzyl-1-azacycloocta-7,8-diene is sourced from PubChem (CID 12672486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).