C27H40O3 — CID 126724965
[(3Z,5E)-5-[2-[4-(2-methylbutan-2-yloxy)phenyl]propan-2-yl]hepta-1,3,5-trien-2-yl] 2,2-dimethylbutanoate (PubChem CID 126724965) has the molecular formula C27H40O3 and a molecular weight of 412.61 g/mol. Its IUPAC name is [(3Z,5E)-5-[2-[4-(2-methylbutan-2-yloxy)phenyl]propan-2-yl]hepta-1,3,5-trien-2-yl] 2,2-dimethylbutanoate.
| Compound Name | [(3Z,5E)-5-[2-[4-(2-methylbutan-2-yloxy)phenyl]propan-2-yl]hepta-1,3,5-trien-2-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 126724965 |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | [(3Z,5E)-5-[2-[4-(2-methylbutan-2-yloxy)phenyl]propan-2-yl]hepta-1,3,5-trien-2-yl] 2,2-dimethylbutanoate |
| SMILES | C=C(/C=C\C(=C/C)C(C)(C)c1ccc(OC(C)(C)CC)cc1)OC(=O)C(C)(C)CC |
| InChI | InChI=1S/C27H40O3/c1-11-21(15-14-20(4)29-24(28)25(5,6)12-2)27(9,10)22-16-18-23(19-17-22)30-26(7,8)13-3/h11,14-19H,4,12-13H2,1-3,5-10H3/b15-14-,21-11+ |
| InChIKey | LWPXLHSLGDTMGF-DYENBZIJSA-N |
| XLogP | 7.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|