C21H20F2N4O2 — CID 126725379
methyl 3-[6-[[(3S)-3-fluoro-4-(3-fluoro-2-pyridinyl)butyl]amino]pyridazin-3-yl]benzoate (PubChem CID 126725379) has the molecular formula C21H20F2N4O2 and a molecular weight of 398.41 g/mol. Its IUPAC name is methyl 3-[6-[[(3S)-3-fluoro-4-(3-fluoro-2-pyridinyl)butyl]amino]pyridazin-3-yl]benzoate.
| Compound Name | methyl 3-[6-[[(3S)-3-fluoro-4-(3-fluoro-2-pyridinyl)butyl]amino]pyridazin-3-yl]benzoate |
|---|---|
| PubChem CID | 126725379 |
| Molecular Formula | C21H20F2N4O2 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | methyl 3-[6-[[(3S)-3-fluoro-4-(3-fluoro-2-pyridinyl)butyl]amino]pyridazin-3-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(NCC[C@H](F)Cc3ncccc3F)nn2)c1 |
| InChI | InChI=1S/C21H20F2N4O2/c1-29-21(28)15-5-2-4-14(12-15)18-7-8-20(27-26-18)25-11-9-16(22)13-19-17(23)6-3-10-24-19/h2-8,10,12,16H,9,11,13H2,1H3,(H,25,27)/t16-/m0/s1 |
| InChIKey | TYCUDHNHGDDIQN-INIZCTEOSA-N |
| XLogP | 3.85 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |