C14H17N2+ — CID 126725550
(E)-(4,4-dimethyl-1,2-dihydropyrrolo[1,2-a]indol-9-ium-3-ylidene)methanamine (PubChem CID 126725550) has the molecular formula C14H17N2+ and a molecular weight of 213.30 g/mol. Its IUPAC name is (E)-(4,4-dimethyl-1,2-dihydropyrrolo[1,2-a]indol-9-ium-3-ylidene)methanamine.
| Compound Name | (E)-(4,4-dimethyl-1,2-dihydropyrrolo[1,2-a]indol-9-ium-3-ylidene)methanamine |
|---|---|
| PubChem CID | 126725550 |
| Molecular Formula | C14H17N2+ |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (E)-(4,4-dimethyl-1,2-dihydropyrrolo[1,2-a]indol-9-ium-3-ylidene)methanamine |
| SMILES | CC1(C)C2=[N+](CC/C2=C\N)c2ccccc21 |
| InChI | InChI=1S/C14H16N2/c1-14(2)11-5-3-4-6-12(11)16-8-7-10(9-15)13(14)16/h3-6,9,15H,7-8H2,1-2H3/p+1 |
| InChIKey | KRMYILZBRRFIHE-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 29.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|