About 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-pyrazole
4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-pyrazole (PubChem CID 126725560) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-pyrazole.
Molecular Properties
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-pyrazole |
| PubChem CID | 126725560 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-pyrazole |
| SMILES | C=C/C=C\c1c(C)n[nH]c1C |
| InChI | InChI=1S/C9H12N2/c1-4-5-6-9-7(2)10-11-8(9)3/h4-6H,1H2,2-3H3,(H,10,11)/b6-5- |
| InChIKey | IFJGNYLDFLZYKR-WAYWQWQTSA-N |
| XLogP | 2.23 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-pyrazole?
The IUPAC name of 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-pyrazole (CID 126725560) is 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-pyrazole.
What is the SMILES notation for 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-pyrazole?
The canonical SMILES for 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-pyrazole is C=C/C=C\c1c(C)n[nH]c1C.
What is the InChIKey of 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-pyrazole?
The InChIKey is IFJGNYLDFLZYKR-WAYWQWQTSA-N. The full InChI is InChI=1S/C9H12N2/c1-4-5-6-9-7(2)10-11-8(9)3/h4-6H,1H2,2-3H3,(H,10,11)/b6-5-.
What are the key properties of 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-pyrazole?
4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-pyrazole has a molecular weight of 148.21 g/mol, XLogP of 2.23, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-pyrazole is sourced from PubChem (CID 126725560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).