C16H29N — CID 126725778
(5E,9E)-N-ethyl-5,9-dimethyldodeca-5,9-dien-2-imine (PubChem CID 126725778) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is (5E,9E)-N-ethyl-5,9-dimethyldodeca-5,9-dien-2-imine.
| Compound Name | (5E,9E)-N-ethyl-5,9-dimethyldodeca-5,9-dien-2-imine |
|---|---|
| PubChem CID | 126725778 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (5E,9E)-N-ethyl-5,9-dimethyldodeca-5,9-dien-2-imine |
| SMILES | CC/C=C(\C)CC/C=C(\C)CC/C(C)=N/CC |
| InChI | InChI=1S/C16H29N/c1-6-9-14(3)10-8-11-15(4)12-13-16(5)17-7-2/h9,11H,6-8,10,12-13H2,1-5H3/b14-9+,15-11+,17-16+ |
| InChIKey | QQUDQXXOJDYDLW-PHJRXSGGSA-N |
| XLogP | 5.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|