About N,N-dimethylcyclohepta-2,4,6-triene-1-carboxamide
N,N-dimethylcyclohepta-2,4,6-triene-1-carboxamide (PubChem CID 12672584) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is N,N-dimethylcyclohepta-2,4,6-triene-1-carboxamide.
Molecular Properties
| Compound Name | N,N-dimethylcyclohepta-2,4,6-triene-1-carboxamide |
| PubChem CID | 12672584 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | N,N-dimethylcyclohepta-2,4,6-triene-1-carboxamide |
| SMILES | CN(C)C(=O)C1C=CC=CC=C1 |
| InChI | InChI=1S/C10H13NO/c1-11(2)10(12)9-7-5-3-4-6-8-9/h3-9H,1-2H3 |
| InChIKey | BJIPPBPRFJTNEC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylcyclohepta-2,4,6-triene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylcyclohepta-2,4,6-triene-1-carboxamide?
The IUPAC name of N,N-dimethylcyclohepta-2,4,6-triene-1-carboxamide (CID 12672584) is N,N-dimethylcyclohepta-2,4,6-triene-1-carboxamide.
What is the SMILES notation for N,N-dimethylcyclohepta-2,4,6-triene-1-carboxamide?
The canonical SMILES for N,N-dimethylcyclohepta-2,4,6-triene-1-carboxamide is CN(C)C(=O)C1C=CC=CC=C1.
What is the InChIKey of N,N-dimethylcyclohepta-2,4,6-triene-1-carboxamide?
The InChIKey is BJIPPBPRFJTNEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-11(2)10(12)9-7-5-3-4-6-8-9/h3-9H,1-2H3.
What are the key properties of N,N-dimethylcyclohepta-2,4,6-triene-1-carboxamide?
N,N-dimethylcyclohepta-2,4,6-triene-1-carboxamide has a molecular weight of 163.22 g/mol, XLogP of 1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylcyclohepta-2,4,6-triene-1-carboxamide is sourced from PubChem (CID 12672584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).