C20H22F3N3OS — CID 126726165
4-(5-hexylthiophen-2-yl)-2-methoxy-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (PubChem CID 126726165) has the molecular formula C20H22F3N3OS and a molecular weight of 409.48 g/mol. Its IUPAC name is 4-(5-hexylthiophen-2-yl)-2-methoxy-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
| Compound Name | 4-(5-hexylthiophen-2-yl)-2-methoxy-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
|---|---|
| PubChem CID | 126726165 |
| Molecular Formula | C20H22F3N3OS |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 4-(5-hexylthiophen-2-yl)-2-methoxy-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| SMILES | CCCCCCc1ccc(-c2cc(OC)nc(-c3cc(C(F)(F)F)[nH]n3)c2)s1 |
| InChI | InChI=1S/C20H22F3N3OS/c1-3-4-5-6-7-14-8-9-17(28-14)13-10-15(24-19(11-13)27-2)16-12-18(26-25-16)20(21,22)23/h8-12H,3-7H2,1-2H3,(H,25,26) |
| InChIKey | YETOFISGRLOJST-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|