About 4-pentoxy-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine
4-pentoxy-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (PubChem CID 126726168) has the molecular formula C18H17F6N5O
and a molecular weight of 433.36 g/mol. Its IUPAC name is 4-pentoxy-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
Molecular Properties
| Compound Name | 4-pentoxy-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| PubChem CID | 126726168 |
| Molecular Formula | C18H17F6N5O |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 4-pentoxy-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| SMILES | CCCCCOc1cc(-c2cc(C(F)(F)F)[nH]n2)nc(-c2cc(C(F)(F)F)[nH]n2)c1 |
| InChI | InChI=1S/C18H17F6N5O/c1-2-3-4-5-30-10-6-11(13-8-15(28-26-13)17(19,20)21)25-12(7-10)14-9-16(29-27-14)18(22,23)24/h6-9H,2-5H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | IIEOHQDSPURIBT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-pentoxy-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pentoxy-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The IUPAC name of 4-pentoxy-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (CID 126726168) is 4-pentoxy-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
What is the SMILES notation for 4-pentoxy-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The canonical SMILES for 4-pentoxy-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine is CCCCCOc1cc(-c2cc(C(F)(F)F)[nH]n2)nc(-c2cc(C(F)(F)F)[nH]n2)c1.
What is the InChIKey of 4-pentoxy-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The InChIKey is IIEOHQDSPURIBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F6N5O/c1-2-3-4-5-30-10-6-11(13-8-15(28-26-13)17(19,20)21)25-12(7-10)14-9-16(29-27-14)18(22,23)24/h6-9H,2-5H2,1H3,(H,26,28)(H,27,29).
What are the key properties of 4-pentoxy-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
4-pentoxy-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine has a molecular weight of 433.36 g/mol, XLogP of 5.47, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pentoxy-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine is sourced from PubChem (CID 126726168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).