C33H32F6N6 — CID 126726169
N,N-bis(4-tert-butylphenyl)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridin-4-amine (PubChem CID 126726169) has the molecular formula C33H32F6N6 and a molecular weight of 626.65 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridin-4-amine.
| Compound Name | N,N-bis(4-tert-butylphenyl)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridin-4-amine |
|---|---|
| PubChem CID | 126726169 |
| Molecular Formula | C33H32F6N6 |
| Molecular Weight | 626.65 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridin-4-amine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2cc(-c3cc(C(F)(F)F)[nH]n3)nc(-c3cc(C(F)(F)F)[nH]n3)c2)cc1 |
| InChI | InChI=1S/C33H32F6N6/c1-30(2,3)19-7-11-21(12-8-19)45(22-13-9-20(10-14-22)31(4,5)6)23-15-24(26-17-28(43-41-26)32(34,35)36)40-25(16-23)27-18-29(44-42-27)33(37,38)39/h7-18H,1-6H3,(H,41,43)(H,42,44) |
| InChIKey | PKNADGNDYNMKNN-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.65 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |