About 4-(2-butyloctoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine
4-(2-butyloctoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (PubChem CID 126726185) has the molecular formula C25H31F6N5O
and a molecular weight of 531.55 g/mol. Its IUPAC name is 4-(2-butyloctoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
Molecular Properties
| Compound Name | 4-(2-butyloctoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| PubChem CID | 126726185 |
| Molecular Formula | C25H31F6N5O |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 4-(2-butyloctoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| SMILES | CCCCCCC(CCCC)COc1cc(-c2cc(C(F)(F)F)[nH]n2)nc(-c2cc(C(F)(F)F)[nH]n2)c1 |
| InChI | InChI=1S/C25H31F6N5O/c1-3-5-7-8-10-16(9-6-4-2)15-37-17-11-18(20-13-22(35-33-20)24(26,27)28)32-19(12-17)21-14-23(36-34-21)25(29,30)31/h11-14,16H,3-10,15H2,1-2H3,(H,33,35)(H,34,36) |
| InChIKey | GUYRRSDBMNOGED-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-butyloctoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-butyloctoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The IUPAC name of 4-(2-butyloctoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (CID 126726185) is 4-(2-butyloctoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
What is the SMILES notation for 4-(2-butyloctoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The canonical SMILES for 4-(2-butyloctoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine is CCCCCCC(CCCC)COc1cc(-c2cc(C(F)(F)F)[nH]n2)nc(-c2cc(C(F)(F)F)[nH]n2)c1.
What is the InChIKey of 4-(2-butyloctoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The InChIKey is GUYRRSDBMNOGED-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31F6N5O/c1-3-5-7-8-10-16(9-6-4-2)15-37-17-11-18(20-13-22(35-33-20)24(26,27)28)32-19(12-17)21-14-23(36-34-21)25(29,30)31/h11-14,16H,3-10,15H2,1-2H3,(H,33,35)(H,34,36).
What are the key properties of 4-(2-butyloctoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
4-(2-butyloctoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine has a molecular weight of 531.55 g/mol, XLogP of 8.06, 13 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-butyloctoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine is sourced from PubChem (CID 126726185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).