About 4-(2-ethylhexoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine
4-(2-ethylhexoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (PubChem CID 126726187) has the molecular formula C21H23F6N5O
and a molecular weight of 475.44 g/mol. Its IUPAC name is 4-(2-ethylhexoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
Molecular Properties
| Compound Name | 4-(2-ethylhexoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| PubChem CID | 126726187 |
| Molecular Formula | C21H23F6N5O |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 4-(2-ethylhexoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| SMILES | CCCCC(CC)COc1cc(-c2cc(C(F)(F)F)[nH]n2)nc(-c2cc(C(F)(F)F)[nH]n2)c1 |
| InChI | InChI=1S/C21H23F6N5O/c1-3-5-6-12(4-2)11-33-13-7-14(16-9-18(31-29-16)20(22,23)24)28-15(8-13)17-10-19(32-30-17)21(25,26)27/h7-10,12H,3-6,11H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | BSLGVVUTAKPCPT-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-ethylhexoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-ethylhexoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The IUPAC name of 4-(2-ethylhexoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (CID 126726187) is 4-(2-ethylhexoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
What is the SMILES notation for 4-(2-ethylhexoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The canonical SMILES for 4-(2-ethylhexoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine is CCCCC(CC)COc1cc(-c2cc(C(F)(F)F)[nH]n2)nc(-c2cc(C(F)(F)F)[nH]n2)c1.
What is the InChIKey of 4-(2-ethylhexoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The InChIKey is BSLGVVUTAKPCPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23F6N5O/c1-3-5-6-12(4-2)11-33-13-7-14(16-9-18(31-29-16)20(22,23)24)28-15(8-13)17-10-19(32-30-17)21(25,26)27/h7-10,12H,3-6,11H2,1-2H3,(H,29,31)(H,30,32).
What are the key properties of 4-(2-ethylhexoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
4-(2-ethylhexoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine has a molecular weight of 475.44 g/mol, XLogP of 6.49, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethylhexoxy)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine is sourced from PubChem (CID 126726187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).