C46H41NO5S — CID 126726772
(2E)-2-[[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-3-pentoxythiophen-2-yl]methylidene]-1,3-dioxoindene-5-carboxylic acid (PubChem CID 126726772) has the molecular formula C46H41NO5S and a molecular weight of 719.90 g/mol. Its IUPAC name is (2E)-2-[[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-3-pentoxythiophen-2-yl]methylidene]-1,3-dioxoindene-5-carboxylic acid.
| Compound Name | (2E)-2-[[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-3-pentoxythiophen-2-yl]methylidene]-1,3-dioxoindene-5-carboxylic acid |
|---|---|
| PubChem CID | 126726772 |
| Molecular Formula | C46H41NO5S |
| Molecular Weight | 719.90 g/mol |
| Exact Mass | 719.27 |
| IUPAC Name | (2E)-2-[[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]-3-pentoxythiophen-2-yl]methylidene]-1,3-dioxoindene-5-carboxylic acid |
| SMILES | CCCCCOc1cc(-c2ccc3c(c2)C2CCCC2N3c2ccc3c(c2)-c2ccccc2C3(C)C)sc1/C=C1\C(=O)c2ccc(C(=O)O)cc2C1=O |
| InChI | InChI=1S/C46H41NO5S/c1-4-5-8-20-52-40-25-41(53-42(40)24-35-43(48)31-17-14-27(45(50)51)22-34(31)44(35)49)26-15-19-39-33(21-26)30-11-9-13-38(30)47(39)28-16-18-37-32(23-28)29-10-6-7-12-36(29)46(37,2)3/h6-7,10,12,14-19,21-25,30,38H,4-5,8-9,11,13,20H2,1-3H3,(H,50,51)/b35-24+ |
| InChIKey | CVEATPSFIGRNGP-JWHWKPFMSA-N |
| XLogP | 11.24 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.90 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|