C43H33NO4S — CID 126726791
(2E)-2-[(E)-3-[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]thiophen-2-yl]prop-2-enylidene]-1,3-dioxoindene-5-carboxylic acid (PubChem CID 126726791) has the molecular formula C43H33NO4S and a molecular weight of 659.81 g/mol. Its IUPAC name is (2E)-2-[(E)-3-[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]thiophen-2-yl]prop-2-enylidene]-1,3-dioxoindene-5-carboxylic acid.
| Compound Name | (2E)-2-[(E)-3-[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]thiophen-2-yl]prop-2-enylidene]-1,3-dioxoindene-5-carboxylic acid |
|---|---|
| PubChem CID | 126726791 |
| Molecular Formula | C43H33NO4S |
| Molecular Weight | 659.81 g/mol |
| Exact Mass | 659.21 |
| IUPAC Name | (2E)-2-[(E)-3-[5-[4-(9,9-dimethylfluoren-3-yl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]thiophen-2-yl]prop-2-enylidene]-1,3-dioxoindene-5-carboxylic acid |
| SMILES | CC1(C)c2ccccc2-c2cc(N3c4ccc(-c5ccc(/C=C/C=C6\C(=O)c7ccc(C(=O)O)cc7C6=O)s5)cc4C4CCCC43)ccc21 |
| InChI | InChI=1S/C43H33NO4S/c1-43(2)35-11-4-3-8-28(35)32-23-26(15-18-36(32)43)44-37-12-6-9-29(37)33-21-24(14-19-38(33)44)39-20-16-27(49-39)7-5-10-31-40(45)30-17-13-25(42(47)48)22-34(30)41(31)46/h3-5,7-8,10-11,13-23,29,37H,6,9,12H2,1-2H3,(H,47,48)/b7-5+,31-10+ |
| InChIKey | BVBRHPVKYSVZRU-PRJBOTPMSA-N |
| XLogP | 10.23 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.81 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|