C18H17BrN2O3S — CID 126726864
[(3aR,7aR)-7a-(4-bromo-1,3-thiazol-2-yl)spiro[3,3a,4,7-tetrahydropyrano[3,4-c][1,2]oxazole-5,1'-cyclopropane]-1-yl]-phenylmethanone (PubChem CID 126726864) has the molecular formula C18H17BrN2O3S and a molecular weight of 421.32 g/mol. Its IUPAC name is [(3aR,7aR)-7a-(4-bromo-1,3-thiazol-2-yl)spiro[3,3a,4,7-tetrahydropyrano[3,4-c][1,2]oxazole-5,1'-cyclopropane]-1-yl]-phenylmethanone.
| Compound Name | [(3aR,7aR)-7a-(4-bromo-1,3-thiazol-2-yl)spiro[3,3a,4,7-tetrahydropyrano[3,4-c][1,2]oxazole-5,1'-cyclopropane]-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 126726864 |
| Molecular Formula | C18H17BrN2O3S |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | [(3aR,7aR)-7a-(4-bromo-1,3-thiazol-2-yl)spiro[3,3a,4,7-tetrahydropyrano[3,4-c][1,2]oxazole-5,1'-cyclopropane]-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1OC[C@@H]2CC3(CC3)OC[C@@]21c1nc(Br)cs1 |
| InChI | InChI=1S/C18H17BrN2O3S/c19-14-10-25-16(20-14)18-11-23-17(6-7-17)8-13(18)9-24-21(18)15(22)12-4-2-1-3-5-12/h1-5,10,13H,6-9,11H2/t13-,18-/m0/s1 |
| InChIKey | LJHBPQUWSDIAMF-UGSOOPFHSA-N |
| XLogP | 3.76 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |