About N-(6-imino-2,5-dimethylcyclohexa-2,4-dien-1-yl)thiohydroxylamine
N-(6-imino-2,5-dimethylcyclohexa-2,4-dien-1-yl)thiohydroxylamine (PubChem CID 126727062) has the molecular formula C8H12N2S
and a molecular weight of 168.26 g/mol. Its IUPAC name is N-(6-imino-2,5-dimethylcyclohexa-2,4-dien-1-yl)thiohydroxylamine.
Molecular Properties
| Compound Name | N-(6-imino-2,5-dimethylcyclohexa-2,4-dien-1-yl)thiohydroxylamine |
| PubChem CID | 126727062 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | N-(6-imino-2,5-dimethylcyclohexa-2,4-dien-1-yl)thiohydroxylamine |
| SMILES | [H]/N=C1\C(C)=CC=C(C)C1NS |
| InChI | InChI=1S/C8H12N2S/c1-5-3-4-6(2)8(10-11)7(5)9/h3-4,8-11H,1-2H3/b9-7+ |
| InChIKey | HOBSACIANGKSIZ-VQHVLOKHSA-N |
| XLogP | 1.72 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-(6-imino-2,5-dimethylcyclohexa-2,4-dien-1-yl)thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-imino-2,5-dimethylcyclohexa-2,4-dien-1-yl)thiohydroxylamine?
The IUPAC name of N-(6-imino-2,5-dimethylcyclohexa-2,4-dien-1-yl)thiohydroxylamine (CID 126727062) is N-(6-imino-2,5-dimethylcyclohexa-2,4-dien-1-yl)thiohydroxylamine.
What is the SMILES notation for N-(6-imino-2,5-dimethylcyclohexa-2,4-dien-1-yl)thiohydroxylamine?
The canonical SMILES for N-(6-imino-2,5-dimethylcyclohexa-2,4-dien-1-yl)thiohydroxylamine is [H]/N=C1\C(C)=CC=C(C)C1NS.
What is the InChIKey of N-(6-imino-2,5-dimethylcyclohexa-2,4-dien-1-yl)thiohydroxylamine?
The InChIKey is HOBSACIANGKSIZ-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H12N2S/c1-5-3-4-6(2)8(10-11)7(5)9/h3-4,8-11H,1-2H3/b9-7+.
What are the key properties of N-(6-imino-2,5-dimethylcyclohexa-2,4-dien-1-yl)thiohydroxylamine?
N-(6-imino-2,5-dimethylcyclohexa-2,4-dien-1-yl)thiohydroxylamine has a molecular weight of 168.26 g/mol, XLogP of 1.72, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-imino-2,5-dimethylcyclohexa-2,4-dien-1-yl)thiohydroxylamine is sourced from PubChem (CID 126727062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).