C20H38O2 — CID 126727076
4,4-bis(ethenoxymethyl)-2-methyltridecane (PubChem CID 126727076) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is 4,4-bis(ethenoxymethyl)-2-methyltridecane.
| Compound Name | 4,4-bis(ethenoxymethyl)-2-methyltridecane |
|---|---|
| PubChem CID | 126727076 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | 4,4-bis(ethenoxymethyl)-2-methyltridecane |
| SMILES | C=COCC(CCCCCCCCC)(COC=C)CC(C)C |
| InChI | InChI=1S/C20H38O2/c1-6-9-10-11-12-13-14-15-20(16-19(4)5,17-21-7-2)18-22-8-3/h7-8,19H,2-3,6,9-18H2,1,4-5H3 |
| InChIKey | JSPBBBPCAGQYFA-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|