About 4,11-bis(ethenoxymethyl)-4,11-dimethyltetradecane
4,11-bis(ethenoxymethyl)-4,11-dimethyltetradecane (PubChem CID 126727084) has the molecular formula C22H42O2
and a molecular weight of 338.58 g/mol. Its IUPAC name is 4,11-bis(ethenoxymethyl)-4,11-dimethyltetradecane.
Molecular Properties
| Compound Name | 4,11-bis(ethenoxymethyl)-4,11-dimethyltetradecane |
| PubChem CID | 126727084 |
| Molecular Formula | C22H42O2 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.32 |
| IUPAC Name | 4,11-bis(ethenoxymethyl)-4,11-dimethyltetradecane |
| SMILES | C=COCC(C)(CCC)CCCCCCC(C)(CCC)COC=C |
| InChI | InChI=1S/C22H42O2/c1-7-15-21(5,19-23-9-3)17-13-11-12-14-18-22(6,16-8-2)20-24-10-4/h9-10H,3-4,7-8,11-20H2,1-2,5-6H3 |
| InChIKey | ZDYNVPVFDHUVPY-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,11-bis(ethenoxymethyl)-4,11-dimethyltetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,11-bis(ethenoxymethyl)-4,11-dimethyltetradecane?
The IUPAC name of 4,11-bis(ethenoxymethyl)-4,11-dimethyltetradecane (CID 126727084) is 4,11-bis(ethenoxymethyl)-4,11-dimethyltetradecane.
What is the SMILES notation for 4,11-bis(ethenoxymethyl)-4,11-dimethyltetradecane?
The canonical SMILES for 4,11-bis(ethenoxymethyl)-4,11-dimethyltetradecane is C=COCC(C)(CCC)CCCCCCC(C)(CCC)COC=C.
What is the InChIKey of 4,11-bis(ethenoxymethyl)-4,11-dimethyltetradecane?
The InChIKey is ZDYNVPVFDHUVPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O2/c1-7-15-21(5,19-23-9-3)17-13-11-12-14-18-22(6,16-8-2)20-24-10-4/h9-10H,3-4,7-8,11-20H2,1-2,5-6H3.
What are the key properties of 4,11-bis(ethenoxymethyl)-4,11-dimethyltetradecane?
4,11-bis(ethenoxymethyl)-4,11-dimethyltetradecane has a molecular weight of 338.58 g/mol, XLogP of 7.26, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,11-bis(ethenoxymethyl)-4,11-dimethyltetradecane is sourced from PubChem (CID 126727084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).