C26H48O3 — CID 126727092
1,13-bis(ethenoxy)-7-(2-ethenoxypropan-2-yl)-2,2,12,12-tetramethyltridecane (PubChem CID 126727092) has the molecular formula C26H48O3 and a molecular weight of 408.67 g/mol. Its IUPAC name is 1,13-bis(ethenoxy)-7-(2-ethenoxypropan-2-yl)-2,2,12,12-tetramethyltridecane.
| Compound Name | 1,13-bis(ethenoxy)-7-(2-ethenoxypropan-2-yl)-2,2,12,12-tetramethyltridecane |
|---|---|
| PubChem CID | 126727092 |
| Molecular Formula | C26H48O3 |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 408.36 |
| IUPAC Name | 1,13-bis(ethenoxy)-7-(2-ethenoxypropan-2-yl)-2,2,12,12-tetramethyltridecane |
| SMILES | C=COCC(C)(C)CCCCC(CCCCC(C)(C)COC=C)C(C)(C)OC=C |
| InChI | InChI=1S/C26H48O3/c1-10-27-21-24(4,5)19-15-13-17-23(26(8,9)29-12-3)18-14-16-20-25(6,7)22-28-11-2/h10-12,23H,1-3,13-22H2,4-9H3 |
| InChIKey | FZVMAZCKZSKVEM-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|