About tetradecane-6,9-dione
tetradecane-6,9-dione (PubChem CID 12672728) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is tetradecane-6,9-dione.
Molecular Properties
| Compound Name | tetradecane-6,9-dione |
| PubChem CID | 12672728 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | tetradecane-6,9-dione |
| SMILES | CCCCCC(=O)CCC(=O)CCCCC |
| InChI | InChI=1S/C14H26O2/c1-3-5-7-9-13(15)11-12-14(16)10-8-6-4-2/h3-12H2,1-2H3 |
| InChIKey | FNRBESAVUXLPQB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tetradecane-6,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetradecane-6,9-dione?
The IUPAC name of tetradecane-6,9-dione (CID 12672728) is tetradecane-6,9-dione.
What is the SMILES notation for tetradecane-6,9-dione?
The canonical SMILES for tetradecane-6,9-dione is CCCCCC(=O)CCC(=O)CCCCC.
What is the InChIKey of tetradecane-6,9-dione?
The InChIKey is FNRBESAVUXLPQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2/c1-3-5-7-9-13(15)11-12-14(16)10-8-6-4-2/h3-12H2,1-2H3.
What are the key properties of tetradecane-6,9-dione?
tetradecane-6,9-dione has a molecular weight of 226.36 g/mol, XLogP of 4.07, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetradecane-6,9-dione is sourced from PubChem (CID 12672728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).