C16H24F2O — CID 126727494
1-[(1Z,3Z)-4-ethoxy-2,3-difluorohexa-1,3,5-trienyl]-4-methylcycloheptane (PubChem CID 126727494) has the molecular formula C16H24F2O and a molecular weight of 270.36 g/mol. Its IUPAC name is 1-[(1Z,3Z)-4-ethoxy-2,3-difluorohexa-1,3,5-trienyl]-4-methylcycloheptane.
| Compound Name | 1-[(1Z,3Z)-4-ethoxy-2,3-difluorohexa-1,3,5-trienyl]-4-methylcycloheptane |
|---|---|
| PubChem CID | 126727494 |
| Molecular Formula | C16H24F2O |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 1-[(1Z,3Z)-4-ethoxy-2,3-difluorohexa-1,3,5-trienyl]-4-methylcycloheptane |
| SMILES | C=C/C(OCC)=C(F)\C(F)=C\C1CCCC(C)CC1 |
| InChI | InChI=1S/C16H24F2O/c1-4-15(19-5-2)16(18)14(17)11-13-8-6-7-12(3)9-10-13/h4,11-13H,1,5-10H2,2-3H3/b14-11-,16-15- |
| InChIKey | SEFJSFBFSQPUPU-ZYZFYNRMSA-N |
| XLogP | 5.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|