C24H32F2O — CID 126727501
1-[(3E,5E,7E)-7-[(2E)-2-[(Z)-2,3-difluoro-1-propoxyprop-2-enylidene]cyclobutylidene]hepta-1,3,5-trien-3-yl]-4-methylcyclohexane (PubChem CID 126727501) has the molecular formula C24H32F2O and a molecular weight of 374.52 g/mol. Its IUPAC name is 1-[(3E,5E,7E)-7-[(2E)-2-[(Z)-2,3-difluoro-1-propoxyprop-2-enylidene]cyclobutylidene]hepta-1,3,5-trien-3-yl]-4-methylcyclohexane.
| Compound Name | 1-[(3E,5E,7E)-7-[(2E)-2-[(Z)-2,3-difluoro-1-propoxyprop-2-enylidene]cyclobutylidene]hepta-1,3,5-trien-3-yl]-4-methylcyclohexane |
|---|---|
| PubChem CID | 126727501 |
| Molecular Formula | C24H32F2O |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 1-[(3E,5E,7E)-7-[(2E)-2-[(Z)-2,3-difluoro-1-propoxyprop-2-enylidene]cyclobutylidene]hepta-1,3,5-trien-3-yl]-4-methylcyclohexane |
| SMILES | C=C/C(=C\C=C\C=C1/CC/C1=C(OCCC)/C(F)=C/F)C1CCC(C)CC1 |
| InChI | InChI=1S/C24H32F2O/c1-4-16-27-24(23(26)17-25)22-15-14-21(22)9-7-6-8-19(5-2)20-12-10-18(3)11-13-20/h5-9,17-18,20H,2,4,10-16H2,1,3H3/b7-6+,19-8+,21-9+,23-17-,24-22+ |
| InChIKey | ILBSVGMLTJTDHZ-AVSDKNKUSA-N |
| XLogP | 7.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|