C25H38F2O2 — CID 126727504
1-[[(1E,3E,5Z)-5,6-difluoro-4-propoxyhexa-1,3,5-trienoxy]methyl]-4-(4-ethenylcyclohexyl)cycloheptane (PubChem CID 126727504) has the molecular formula C25H38F2O2 and a molecular weight of 408.57 g/mol. Its IUPAC name is 1-[[(1E,3E,5Z)-5,6-difluoro-4-propoxyhexa-1,3,5-trienoxy]methyl]-4-(4-ethenylcyclohexyl)cycloheptane.
| Compound Name | 1-[[(1E,3E,5Z)-5,6-difluoro-4-propoxyhexa-1,3,5-trienoxy]methyl]-4-(4-ethenylcyclohexyl)cycloheptane |
|---|---|
| PubChem CID | 126727504 |
| Molecular Formula | C25H38F2O2 |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 1-[[(1E,3E,5Z)-5,6-difluoro-4-propoxyhexa-1,3,5-trienoxy]methyl]-4-(4-ethenylcyclohexyl)cycloheptane |
| SMILES | C=CC1CCC(C2CCCC(CO/C=C/C=C(OCCC)\C(F)=C\F)CC2)CC1 |
| InChI | InChI=1S/C25H38F2O2/c1-3-16-29-25(24(27)18-26)9-6-17-28-19-21-7-5-8-22(15-12-21)23-13-10-20(4-2)11-14-23/h4,6,9,17-18,20-23H,2-3,5,7-8,10-16,19H2,1H3/b17-6+,24-18-,25-9+ |
| InChIKey | DCNIACKDUAYLCB-IXJVMXNDSA-N |
| XLogP | 7.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|