methyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate

C13H18O9 — CID 126727520

IUPACmethyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate
SMILESCOC(=O)[C@H]1OC[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O
InChIInChI=1S/C13H18O9/c1-6(14)20-9-5-19-12(13(17)18-4)11(22-8(3)16)10(9)21-7(2)15/h9-12H,5H2,1-4H3/t9-,10+,11-,12-/m0/s1
InChIKeyQJTZNWRABBGSCY-USZNOCQGSA-N
MW318.28 g/mol
LogP-0.65
Rot. Bonds4

About methyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate

methyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate (PubChem CID 126727520) has the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. Its IUPAC name is methyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate.

Molecular Properties

Compound Namemethyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate
PubChem CID126727520
Molecular FormulaC13H18O9
Molecular Weight318.28 g/mol
Exact Mass318.10
IUPAC Namemethyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate
SMILESCOC(=O)[C@H]1OC[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O
InChIInChI=1S/C13H18O9/c1-6(14)20-9-5-19-12(13(17)18-4)11(22-8(3)16)10(9)21-7(2)15/h9-12H,5H2,1-4H3/t9-,10+,11-,12-/m0/s1
InChIKeyQJTZNWRABBGSCY-USZNOCQGSA-N
XLogP-0.65
TPSA114.43 Ų
H-Bond Donors
H-Bond Acceptors9
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.28
LogP ≤ 5-0.65
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 109

Computed Properties (RDKit)

Structural Alerts{'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}

Analyze methyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate?
The IUPAC name of methyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate (CID 126727520) is methyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate.
What is the SMILES notation for methyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate?
The canonical SMILES for methyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate is COC(=O)[C@H]1OC[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O.
What is the InChIKey of methyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate?
The InChIKey is QJTZNWRABBGSCY-USZNOCQGSA-N. The full InChI is InChI=1S/C13H18O9/c1-6(14)20-9-5-19-12(13(17)18-4)11(22-8(3)16)10(9)21-7(2)15/h9-12H,5H2,1-4H3/t9-,10+,11-,12-/m0/s1.
What are the key properties of methyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate?
methyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate has a molecular weight of 318.28 g/mol, XLogP of -0.65, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,3S,4R,5S)-3,4,5-triacetyloxyoxane-2-carboxylate is sourced from PubChem (CID 126727520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).