C24H36F2O — CID 126727542
(1Z,3E,5E,7E,9E)-11-butyl-10-ethenyl-3-ethoxy-1,2-difluoro-14-methylpentadeca-1,3,5,7,9-pentaene (PubChem CID 126727542) has the molecular formula C24H36F2O and a molecular weight of 378.55 g/mol. Its IUPAC name is (1Z,3E,5E,7E,9E)-11-butyl-10-ethenyl-3-ethoxy-1,2-difluoro-14-methylpentadeca-1,3,5,7,9-pentaene.
| Compound Name | (1Z,3E,5E,7E,9E)-11-butyl-10-ethenyl-3-ethoxy-1,2-difluoro-14-methylpentadeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 126727542 |
| Molecular Formula | C24H36F2O |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | (1Z,3E,5E,7E,9E)-11-butyl-10-ethenyl-3-ethoxy-1,2-difluoro-14-methylpentadeca-1,3,5,7,9-pentaene |
| SMILES | C=C/C(=C\C=C\C=C\C=C(OCC)/C(F)=C/F)C(CCCC)CCC(C)C |
| InChI | InChI=1S/C24H36F2O/c1-6-9-14-22(18-17-20(4)5)21(7-2)15-12-10-11-13-16-24(27-8-3)23(26)19-25/h7,10-13,15-16,19-20,22H,2,6,8-9,14,17-18H2,1,3-5H3/b12-10+,13-11+,21-15+,23-19-,24-16+ |
| InChIKey | HWNVPNYOTLHMFE-KBTCJLRISA-N |
| XLogP | 8.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|