C16H26N2 — CID 126727632
3-tert-butyl-5-methyl-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1,5-dihydropyrazole (PubChem CID 126727632) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 3-tert-butyl-5-methyl-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1,5-dihydropyrazole.
| Compound Name | 3-tert-butyl-5-methyl-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1,5-dihydropyrazole |
|---|---|
| PubChem CID | 126727632 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 3-tert-butyl-5-methyl-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-1,5-dihydropyrazole |
| SMILES | C/C=C\C=C(/C=C\C)N1NC(C)C=C1C(C)(C)C |
| InChI | InChI=1S/C16H26N2/c1-7-9-11-14(10-8-2)18-15(16(4,5)6)12-13(3)17-18/h7-13,17H,1-6H3/b9-7-,10-8-,14-11+ |
| InChIKey | VYVKWWVLVQJNDG-JUGZTTJASA-N |
| XLogP | 4.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|