About 1-[3-[(2E,4E)-1-methoxyhepta-2,4-dien-2-yl]oxypropyl]-4-propylpiperazine
1-[3-[(2E,4E)-1-methoxyhepta-2,4-dien-2-yl]oxypropyl]-4-propylpiperazine (PubChem CID 126727657) has the molecular formula C18H34N2O2
and a molecular weight of 310.48 g/mol. Its IUPAC name is 1-[3-[(2E,4E)-1-methoxyhepta-2,4-dien-2-yl]oxypropyl]-4-propylpiperazine.
Molecular Properties
| Compound Name | 1-[3-[(2E,4E)-1-methoxyhepta-2,4-dien-2-yl]oxypropyl]-4-propylpiperazine |
| PubChem CID | 126727657 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | 1-[3-[(2E,4E)-1-methoxyhepta-2,4-dien-2-yl]oxypropyl]-4-propylpiperazine |
| SMILES | CC/C=C/C=C(\COC)OCCCN1CCN(CCC)CC1 |
| InChI | InChI=1S/C18H34N2O2/c1-4-6-7-9-18(17-21-3)22-16-8-11-20-14-12-19(10-5-2)13-15-20/h6-7,9H,4-5,8,10-17H2,1-3H3/b7-6+,18-9+ |
| InChIKey | GMBHKEGMFZHKRC-VNDALFFJSA-N |
| XLogP | 2.92 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[(2E,4E)-1-methoxyhepta-2,4-dien-2-yl]oxypropyl]-4-propylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(2E,4E)-1-methoxyhepta-2,4-dien-2-yl]oxypropyl]-4-propylpiperazine?
The IUPAC name of 1-[3-[(2E,4E)-1-methoxyhepta-2,4-dien-2-yl]oxypropyl]-4-propylpiperazine (CID 126727657) is 1-[3-[(2E,4E)-1-methoxyhepta-2,4-dien-2-yl]oxypropyl]-4-propylpiperazine.
What is the SMILES notation for 1-[3-[(2E,4E)-1-methoxyhepta-2,4-dien-2-yl]oxypropyl]-4-propylpiperazine?
The canonical SMILES for 1-[3-[(2E,4E)-1-methoxyhepta-2,4-dien-2-yl]oxypropyl]-4-propylpiperazine is CC/C=C/C=C(\COC)OCCCN1CCN(CCC)CC1.
What is the InChIKey of 1-[3-[(2E,4E)-1-methoxyhepta-2,4-dien-2-yl]oxypropyl]-4-propylpiperazine?
The InChIKey is GMBHKEGMFZHKRC-VNDALFFJSA-N. The full InChI is InChI=1S/C18H34N2O2/c1-4-6-7-9-18(17-21-3)22-16-8-11-20-14-12-19(10-5-2)13-15-20/h6-7,9H,4-5,8,10-17H2,1-3H3/b7-6+,18-9+.
What are the key properties of 1-[3-[(2E,4E)-1-methoxyhepta-2,4-dien-2-yl]oxypropyl]-4-propylpiperazine?
1-[3-[(2E,4E)-1-methoxyhepta-2,4-dien-2-yl]oxypropyl]-4-propylpiperazine has a molecular weight of 310.48 g/mol, XLogP of 2.92, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(2E,4E)-1-methoxyhepta-2,4-dien-2-yl]oxypropyl]-4-propylpiperazine is sourced from PubChem (CID 126727657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).