About 1-(3-fluoro-5-methyl-5-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrrolidine
1-(3-fluoro-5-methyl-5-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrrolidine (PubChem CID 126727857) has the molecular formula C14H22FN
and a molecular weight of 223.33 g/mol. Its IUPAC name is 1-(3-fluoro-5-methyl-5-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrrolidine.
Molecular Properties
| Compound Name | 1-(3-fluoro-5-methyl-5-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrrolidine |
| PubChem CID | 126727857 |
| Molecular Formula | C14H22FN |
| Molecular Weight | 223.33 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 1-(3-fluoro-5-methyl-5-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrrolidine |
| SMILES | CC(C)C1(C)C=C(F)C=C(N2CCCC2)C1 |
| InChI | InChI=1S/C14H22FN/c1-11(2)14(3)9-12(15)8-13(10-14)16-6-4-5-7-16/h8-9,11H,4-7,10H2,1-3H3 |
| InChIKey | DJJQNMMEJYTLAT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3-fluoro-5-methyl-5-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-fluoro-5-methyl-5-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrrolidine?
The IUPAC name of 1-(3-fluoro-5-methyl-5-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrrolidine (CID 126727857) is 1-(3-fluoro-5-methyl-5-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrrolidine.
What is the SMILES notation for 1-(3-fluoro-5-methyl-5-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrrolidine?
The canonical SMILES for 1-(3-fluoro-5-methyl-5-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrrolidine is CC(C)C1(C)C=C(F)C=C(N2CCCC2)C1.
What is the InChIKey of 1-(3-fluoro-5-methyl-5-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrrolidine?
The InChIKey is DJJQNMMEJYTLAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22FN/c1-11(2)14(3)9-12(15)8-13(10-14)16-6-4-5-7-16/h8-9,11H,4-7,10H2,1-3H3.
What are the key properties of 1-(3-fluoro-5-methyl-5-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrrolidine?
1-(3-fluoro-5-methyl-5-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrrolidine has a molecular weight of 223.33 g/mol, XLogP of 3.89, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluoro-5-methyl-5-propan-2-ylcyclohexa-1,3-dien-1-yl)pyrrolidine is sourced from PubChem (CID 126727857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).