About 4-(3-hexylthiolan-2-yl)-2,6-dimethyl-1,2-dihydropyridine
4-(3-hexylthiolan-2-yl)-2,6-dimethyl-1,2-dihydropyridine (PubChem CID 126728000) has the molecular formula C17H29NS
and a molecular weight of 279.49 g/mol. Its IUPAC name is 4-(3-hexylthiolan-2-yl)-2,6-dimethyl-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 4-(3-hexylthiolan-2-yl)-2,6-dimethyl-1,2-dihydropyridine |
| PubChem CID | 126728000 |
| Molecular Formula | C17H29NS |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 4-(3-hexylthiolan-2-yl)-2,6-dimethyl-1,2-dihydropyridine |
| SMILES | CCCCCCC1CCSC1C1=CC(C)NC(C)=C1 |
| InChI | InChI=1S/C17H29NS/c1-4-5-6-7-8-15-9-10-19-17(15)16-11-13(2)18-14(3)12-16/h11-13,15,17-18H,4-10H2,1-3H3 |
| InChIKey | HMSAOCNWTVKTDN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-hexylthiolan-2-yl)-2,6-dimethyl-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-hexylthiolan-2-yl)-2,6-dimethyl-1,2-dihydropyridine?
The IUPAC name of 4-(3-hexylthiolan-2-yl)-2,6-dimethyl-1,2-dihydropyridine (CID 126728000) is 4-(3-hexylthiolan-2-yl)-2,6-dimethyl-1,2-dihydropyridine.
What is the SMILES notation for 4-(3-hexylthiolan-2-yl)-2,6-dimethyl-1,2-dihydropyridine?
The canonical SMILES for 4-(3-hexylthiolan-2-yl)-2,6-dimethyl-1,2-dihydropyridine is CCCCCCC1CCSC1C1=CC(C)NC(C)=C1.
What is the InChIKey of 4-(3-hexylthiolan-2-yl)-2,6-dimethyl-1,2-dihydropyridine?
The InChIKey is HMSAOCNWTVKTDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NS/c1-4-5-6-7-8-15-9-10-19-17(15)16-11-13(2)18-14(3)12-16/h11-13,15,17-18H,4-10H2,1-3H3.
What are the key properties of 4-(3-hexylthiolan-2-yl)-2,6-dimethyl-1,2-dihydropyridine?
4-(3-hexylthiolan-2-yl)-2,6-dimethyl-1,2-dihydropyridine has a molecular weight of 279.49 g/mol, XLogP of 4.90, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-hexylthiolan-2-yl)-2,6-dimethyl-1,2-dihydropyridine is sourced from PubChem (CID 126728000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).