About (Z)-1-(2,6-dimethyl-1,2-dihydropyridin-4-yl)but-1-ene-1-thiol
(Z)-1-(2,6-dimethyl-1,2-dihydropyridin-4-yl)but-1-ene-1-thiol (PubChem CID 126728026) has the molecular formula C11H17NS
and a molecular weight of 195.33 g/mol. Its IUPAC name is (Z)-1-(2,6-dimethyl-1,2-dihydropyridin-4-yl)but-1-ene-1-thiol.
Molecular Properties
| Compound Name | (Z)-1-(2,6-dimethyl-1,2-dihydropyridin-4-yl)but-1-ene-1-thiol |
| PubChem CID | 126728026 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | (Z)-1-(2,6-dimethyl-1,2-dihydropyridin-4-yl)but-1-ene-1-thiol |
| SMILES | CC/C=C(\S)C1=CC(C)NC(C)=C1 |
| InChI | InChI=1S/C11H17NS/c1-4-5-11(13)10-6-8(2)12-9(3)7-10/h5-8,12-13H,4H2,1-3H3/b11-5- |
| InChIKey | QYGUZFXFBFDCPQ-WZUFQYTHSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(2,6-dimethyl-1,2-dihydropyridin-4-yl)but-1-ene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(2,6-dimethyl-1,2-dihydropyridin-4-yl)but-1-ene-1-thiol?
The IUPAC name of (Z)-1-(2,6-dimethyl-1,2-dihydropyridin-4-yl)but-1-ene-1-thiol (CID 126728026) is (Z)-1-(2,6-dimethyl-1,2-dihydropyridin-4-yl)but-1-ene-1-thiol.
What is the SMILES notation for (Z)-1-(2,6-dimethyl-1,2-dihydropyridin-4-yl)but-1-ene-1-thiol?
The canonical SMILES for (Z)-1-(2,6-dimethyl-1,2-dihydropyridin-4-yl)but-1-ene-1-thiol is CC/C=C(\S)C1=CC(C)NC(C)=C1.
What is the InChIKey of (Z)-1-(2,6-dimethyl-1,2-dihydropyridin-4-yl)but-1-ene-1-thiol?
The InChIKey is QYGUZFXFBFDCPQ-WZUFQYTHSA-N. The full InChI is InChI=1S/C11H17NS/c1-4-5-11(13)10-6-8(2)12-9(3)7-10/h5-8,12-13H,4H2,1-3H3/b11-5-.
What are the key properties of (Z)-1-(2,6-dimethyl-1,2-dihydropyridin-4-yl)but-1-ene-1-thiol?
(Z)-1-(2,6-dimethyl-1,2-dihydropyridin-4-yl)but-1-ene-1-thiol has a molecular weight of 195.33 g/mol, XLogP of 3.03, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(2,6-dimethyl-1,2-dihydropyridin-4-yl)but-1-ene-1-thiol is sourced from PubChem (CID 126728026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).