C21H37N3 — CID 126728107
2-(4,6-dipentylcyclohex-2-en-1-yl)-4,6-dimethyl-1,4-dihydro-1,3,5-triazine (PubChem CID 126728107) has the molecular formula C21H37N3 and a molecular weight of 331.55 g/mol. Its IUPAC name is 2-(4,6-dipentylcyclohex-2-en-1-yl)-4,6-dimethyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-(4,6-dipentylcyclohex-2-en-1-yl)-4,6-dimethyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 126728107 |
| Molecular Formula | C21H37N3 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.30 |
| IUPAC Name | 2-(4,6-dipentylcyclohex-2-en-1-yl)-4,6-dimethyl-1,4-dihydro-1,3,5-triazine |
| SMILES | CCCCCC1C=CC(C2=NC(C)N=C(C)N2)C(CCCCC)C1 |
| InChI | InChI=1S/C21H37N3/c1-5-7-9-11-18-13-14-20(19(15-18)12-10-8-6-2)21-23-16(3)22-17(4)24-21/h13-14,16,18-20H,5-12,15H2,1-4H3,(H,22,23,24) |
| InChIKey | ACDCQGMAHOZNOS-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|