C9H18N2 — CID 126728114
3-ethyl-2,4,6-trimethyl-3,4-dihydro-1H-pyridazine (PubChem CID 126728114) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 3-ethyl-2,4,6-trimethyl-3,4-dihydro-1H-pyridazine.
| Compound Name | 3-ethyl-2,4,6-trimethyl-3,4-dihydro-1H-pyridazine |
|---|---|
| PubChem CID | 126728114 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 3-ethyl-2,4,6-trimethyl-3,4-dihydro-1H-pyridazine |
| SMILES | CCC1C(C)C=C(C)NN1C |
| InChI | InChI=1S/C9H18N2/c1-5-9-7(2)6-8(3)10-11(9)4/h6-7,9-10H,5H2,1-4H3 |
| InChIKey | PCDLMPTUGGJHJG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |