C16H23N3 — CID 126728123
2,4-dimethyl-6-(4-pentylcyclohexa-2,4-dien-1-yl)-1,3,5-triazine (PubChem CID 126728123) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 2,4-dimethyl-6-(4-pentylcyclohexa-2,4-dien-1-yl)-1,3,5-triazine.
| Compound Name | 2,4-dimethyl-6-(4-pentylcyclohexa-2,4-dien-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 126728123 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 2,4-dimethyl-6-(4-pentylcyclohexa-2,4-dien-1-yl)-1,3,5-triazine |
| SMILES | CCCCCC1=CCC(c2nc(C)nc(C)n2)C=C1 |
| InChI | InChI=1S/C16H23N3/c1-4-5-6-7-14-8-10-15(11-9-14)16-18-12(2)17-13(3)19-16/h8-10,15H,4-7,11H2,1-3H3 |
| InChIKey | KBIFEUFLGCOPAU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|