About 3,6-dihydroxy-5-methylcyclohex-5-ene-1,2,4-trione
3,6-dihydroxy-5-methylcyclohex-5-ene-1,2,4-trione (PubChem CID 126728139) has the molecular formula C7H6O5
and a molecular weight of 170.12 g/mol. Its IUPAC name is 3,6-dihydroxy-5-methylcyclohex-5-ene-1,2,4-trione.
Molecular Properties
| Compound Name | 3,6-dihydroxy-5-methylcyclohex-5-ene-1,2,4-trione |
| PubChem CID | 126728139 |
| Molecular Formula | C7H6O5 |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 3,6-dihydroxy-5-methylcyclohex-5-ene-1,2,4-trione |
| SMILES | CC1=C(O)C(=O)C(=O)C(O)C1=O |
| InChI | InChI=1S/C7H6O5/c1-2-3(8)5(10)7(12)6(11)4(2)9/h5,9-10H,1H3 |
| InChIKey | SCBZEVJRFXSKEI-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.12 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dihydroxy-5-methylcyclohex-5-ene-1,2,4-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dihydroxy-5-methylcyclohex-5-ene-1,2,4-trione?
The IUPAC name of 3,6-dihydroxy-5-methylcyclohex-5-ene-1,2,4-trione (CID 126728139) is 3,6-dihydroxy-5-methylcyclohex-5-ene-1,2,4-trione.
What is the SMILES notation for 3,6-dihydroxy-5-methylcyclohex-5-ene-1,2,4-trione?
The canonical SMILES for 3,6-dihydroxy-5-methylcyclohex-5-ene-1,2,4-trione is CC1=C(O)C(=O)C(=O)C(O)C1=O.
What is the InChIKey of 3,6-dihydroxy-5-methylcyclohex-5-ene-1,2,4-trione?
The InChIKey is SCBZEVJRFXSKEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O5/c1-2-3(8)5(10)7(12)6(11)4(2)9/h5,9-10H,1H3.
What are the key properties of 3,6-dihydroxy-5-methylcyclohex-5-ene-1,2,4-trione?
3,6-dihydroxy-5-methylcyclohex-5-ene-1,2,4-trione has a molecular weight of 170.12 g/mol, XLogP of -1.10, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dihydroxy-5-methylcyclohex-5-ene-1,2,4-trione is sourced from PubChem (CID 126728139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).