About 2,7-dimethyl-1,2-dihydroazepine-5-thione
2,7-dimethyl-1,2-dihydroazepine-5-thione (PubChem CID 126728245) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is 2,7-dimethyl-1,2-dihydroazepine-5-thione.
Molecular Properties
| Compound Name | 2,7-dimethyl-1,2-dihydroazepine-5-thione |
| PubChem CID | 126728245 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 2,7-dimethyl-1,2-dihydroazepine-5-thione |
| SMILES | CC1=CC(=S)C=CC(C)N1 |
| InChI | InChI=1S/C8H11NS/c1-6-3-4-8(10)5-7(2)9-6/h3-6,9H,1-2H3 |
| InChIKey | RZPQDDRFUAWGMS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dimethyl-1,2-dihydroazepine-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethyl-1,2-dihydroazepine-5-thione?
The IUPAC name of 2,7-dimethyl-1,2-dihydroazepine-5-thione (CID 126728245) is 2,7-dimethyl-1,2-dihydroazepine-5-thione.
What is the SMILES notation for 2,7-dimethyl-1,2-dihydroazepine-5-thione?
The canonical SMILES for 2,7-dimethyl-1,2-dihydroazepine-5-thione is CC1=CC(=S)C=CC(C)N1.
What is the InChIKey of 2,7-dimethyl-1,2-dihydroazepine-5-thione?
The InChIKey is RZPQDDRFUAWGMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS/c1-6-3-4-8(10)5-7(2)9-6/h3-6,9H,1-2H3.
What are the key properties of 2,7-dimethyl-1,2-dihydroazepine-5-thione?
2,7-dimethyl-1,2-dihydroazepine-5-thione has a molecular weight of 153.25 g/mol, XLogP of 1.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-1,2-dihydroazepine-5-thione is sourced from PubChem (CID 126728245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).