C22H39N3 — CID 126728315
2-(4,6-dipentylcyclohex-2-en-1-yl)-1,4,6-trimethyl-2H-1,3,5-triazine (PubChem CID 126728315) has the molecular formula C22H39N3 and a molecular weight of 345.58 g/mol. Its IUPAC name is 2-(4,6-dipentylcyclohex-2-en-1-yl)-1,4,6-trimethyl-2H-1,3,5-triazine.
| Compound Name | 2-(4,6-dipentylcyclohex-2-en-1-yl)-1,4,6-trimethyl-2H-1,3,5-triazine |
|---|---|
| PubChem CID | 126728315 |
| Molecular Formula | C22H39N3 |
| Molecular Weight | 345.58 g/mol |
| Exact Mass | 345.31 |
| IUPAC Name | 2-(4,6-dipentylcyclohex-2-en-1-yl)-1,4,6-trimethyl-2H-1,3,5-triazine |
| SMILES | CCCCCC1C=CC(C2N=C(C)N=C(C)N2C)C(CCCCC)C1 |
| InChI | InChI=1S/C22H39N3/c1-6-8-10-12-19-14-15-21(20(16-19)13-11-9-7-2)22-24-17(3)23-18(4)25(22)5/h14-15,19-22H,6-13,16H2,1-5H3 |
| InChIKey | OGGKDVPCXOUJCK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|