C25H28N6O2S — CID 126728422
(5Z)-5-[[2-[[4-[(2-methyl-1,2-dihydroquinolin-4-yl)methylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126728422) has the molecular formula C25H28N6O2S and a molecular weight of 476.61 g/mol. Its IUPAC name is (5Z)-5-[[2-[[4-[(2-methyl-1,2-dihydroquinolin-4-yl)methylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[[4-[(2-methyl-1,2-dihydroquinolin-4-yl)methylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126728422 |
| Molecular Formula | C25H28N6O2S |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | (5Z)-5-[[2-[[4-[(2-methyl-1,2-dihydroquinolin-4-yl)methylamino]cyclohexyl]amino]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC1C=C(CNC2CCC(Nc3nccc(/C=C4\SC(=O)NC4=O)n3)CC2)c2ccccc2N1 |
| InChI | InChI=1S/C25H28N6O2S/c1-15-12-16(20-4-2-3-5-21(20)28-15)14-27-17-6-8-18(9-7-17)29-24-26-11-10-19(30-24)13-22-23(32)31-25(33)34-22/h2-5,10-13,15,17-18,27-28H,6-9,14H2,1H3,(H,26,29,30)(H,31,32,33)/b22-13- |
| InChIKey | WXCVTNXOLVLGED-XKZIYDEJSA-N |
| XLogP | 4.01 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|