C5H5N11O6 — CID 126728599
2-[[5-(2-hydroxy-5-nitro-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazol-1-yl]oxy]guanidine (PubChem CID 126728599) has the molecular formula C5H5N11O6 and a molecular weight of 315.17 g/mol. Its IUPAC name is 2-[[5-(2-hydroxy-5-nitro-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazol-1-yl]oxy]guanidine.
| Compound Name | 2-[[5-(2-hydroxy-5-nitro-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazol-1-yl]oxy]guanidine |
|---|---|
| PubChem CID | 126728599 |
| Molecular Formula | C5H5N11O6 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2-[[5-(2-hydroxy-5-nitro-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazol-1-yl]oxy]guanidine |
| SMILES | NC(N)=NOn1nc([N+](=O)[O-])nc1-c1nc([N+](=O)[O-])nn1O |
| InChI | InChI=1S/C5H5N11O6/c6-3(7)12-22-14-2(9-5(11-14)16(20)21)1-8-4(15(18)19)10-13(1)17/h17H,(H4,6,7,12) |
| InChIKey | YCSVHFHSQBSMQI-UHFFFAOYSA-N |
| XLogP | -2.79 |
| TPSA | 241.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|