C13H22S — CID 126728897
2-(2,3,3,4-tetramethylpentan-2-yl)thiophene (PubChem CID 126728897) has the molecular formula C13H22S and a molecular weight of 210.39 g/mol. Its IUPAC name is 2-(2,3,3,4-tetramethylpentan-2-yl)thiophene.
| Compound Name | 2-(2,3,3,4-tetramethylpentan-2-yl)thiophene |
|---|---|
| PubChem CID | 126728897 |
| Molecular Formula | C13H22S |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-(2,3,3,4-tetramethylpentan-2-yl)thiophene |
| SMILES | CC(C)C(C)(C)C(C)(C)c1cccs1 |
| InChI | InChI=1S/C13H22S/c1-10(2)12(3,4)13(5,6)11-8-7-9-14-11/h7-10H,1-6H3 |
| InChIKey | JTLAIHYSBALKJQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |