C47H42OS — CID 126729221
(3Z)-6-[(2-buta-1,3-dien-2-ylphenyl)sulfanylmethyl]-4,4,5-trimethyl-3-[(E)-2-(4-triphenylen-2-ylphenyl)but-2-enylidene]pyran (PubChem CID 126729221) has the molecular formula C47H42OS and a molecular weight of 654.92 g/mol. Its IUPAC name is (3Z)-6-[(2-buta-1,3-dien-2-ylphenyl)sulfanylmethyl]-4,4,5-trimethyl-3-[(E)-2-(4-triphenylen-2-ylphenyl)but-2-enylidene]pyran.
| Compound Name | (3Z)-6-[(2-buta-1,3-dien-2-ylphenyl)sulfanylmethyl]-4,4,5-trimethyl-3-[(E)-2-(4-triphenylen-2-ylphenyl)but-2-enylidene]pyran |
|---|---|
| PubChem CID | 126729221 |
| Molecular Formula | C47H42OS |
| Molecular Weight | 654.92 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | (3Z)-6-[(2-buta-1,3-dien-2-ylphenyl)sulfanylmethyl]-4,4,5-trimethyl-3-[(E)-2-(4-triphenylen-2-ylphenyl)but-2-enylidene]pyran |
| SMILES | C=CC(=C)c1ccccc1SCC1=C(C)C(C)(C)/C(=C/C(=C\C)c2ccc(-c3ccc4c5ccccc5c5ccccc5c4c3)cc2)CO1 |
| InChI | InChI=1S/C47H42OS/c1-7-31(3)38-15-13-14-20-46(38)49-30-45-32(4)47(5,6)37(29-48-45)27-33(8-2)34-21-23-35(24-22-34)36-25-26-43-41-18-10-9-16-39(41)40-17-11-12-19-42(40)44(43)28-36/h7-28H,1,3,29-30H2,2,4-6H3/b33-8+,37-27+ |
| InChIKey | FXXRUBQZBRSOQL-PQRYWOPZSA-N |
| XLogP | 13.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.92 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|