About 4-(2-methylthieno[3,2-b]thiophen-5-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine
4-(2-methylthieno[3,2-b]thiophen-5-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (PubChem CID 126729598) has the molecular formula C16H10F3N3S2
and a molecular weight of 365.41 g/mol. Its IUPAC name is 4-(2-methylthieno[3,2-b]thiophen-5-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
Molecular Properties
| Compound Name | 4-(2-methylthieno[3,2-b]thiophen-5-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| PubChem CID | 126729598 |
| Molecular Formula | C16H10F3N3S2 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 4-(2-methylthieno[3,2-b]thiophen-5-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| SMILES | Cc1cc2sc(-c3ccnc(-c4cc(C(F)(F)F)[nH]n4)c3)cc2s1 |
| InChI | InChI=1S/C16H10F3N3S2/c1-8-4-13-14(23-8)7-12(24-13)9-2-3-20-10(5-9)11-6-15(22-21-11)16(17,18)19/h2-7H,1H3,(H,21,22) |
| InChIKey | AOHIQXFKWNLGFR-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-methylthieno[3,2-b]thiophen-5-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylthieno[3,2-b]thiophen-5-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The IUPAC name of 4-(2-methylthieno[3,2-b]thiophen-5-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (CID 126729598) is 4-(2-methylthieno[3,2-b]thiophen-5-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
What is the SMILES notation for 4-(2-methylthieno[3,2-b]thiophen-5-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The canonical SMILES for 4-(2-methylthieno[3,2-b]thiophen-5-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine is Cc1cc2sc(-c3ccnc(-c4cc(C(F)(F)F)[nH]n4)c3)cc2s1.
What is the InChIKey of 4-(2-methylthieno[3,2-b]thiophen-5-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The InChIKey is AOHIQXFKWNLGFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F3N3S2/c1-8-4-13-14(23-8)7-12(24-13)9-2-3-20-10(5-9)11-6-15(22-21-11)16(17,18)19/h2-7H,1H3,(H,21,22).
What are the key properties of 4-(2-methylthieno[3,2-b]thiophen-5-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
4-(2-methylthieno[3,2-b]thiophen-5-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine has a molecular weight of 365.41 g/mol, XLogP of 5.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylthieno[3,2-b]thiophen-5-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine is sourced from PubChem (CID 126729598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).