About 4-(9,9-dimethylfluoren-2-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine
4-(9,9-dimethylfluoren-2-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (PubChem CID 126729682) has the molecular formula C24H18F3N3
and a molecular weight of 405.42 g/mol. Its IUPAC name is 4-(9,9-dimethylfluoren-2-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
Molecular Properties
| Compound Name | 4-(9,9-dimethylfluoren-2-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| PubChem CID | 126729682 |
| Molecular Formula | C24H18F3N3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 4-(9,9-dimethylfluoren-2-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccnc(-c4cc(C(F)(F)F)[nH]n4)c3)cc21 |
| InChI | InChI=1S/C24H18F3N3/c1-23(2)18-6-4-3-5-16(18)17-8-7-14(11-19(17)23)15-9-10-28-20(12-15)21-13-22(30-29-21)24(25,26)27/h3-13H,1-2H3,(H,29,30) |
| InChIKey | VUBMMRVQOHEMPW-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(9,9-dimethylfluoren-2-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(9,9-dimethylfluoren-2-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The IUPAC name of 4-(9,9-dimethylfluoren-2-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (CID 126729682) is 4-(9,9-dimethylfluoren-2-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
What is the SMILES notation for 4-(9,9-dimethylfluoren-2-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The canonical SMILES for 4-(9,9-dimethylfluoren-2-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine is CC1(C)c2ccccc2-c2ccc(-c3ccnc(-c4cc(C(F)(F)F)[nH]n4)c3)cc21.
What is the InChIKey of 4-(9,9-dimethylfluoren-2-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
The InChIKey is VUBMMRVQOHEMPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18F3N3/c1-23(2)18-6-4-3-5-16(18)17-8-7-14(11-19(17)23)15-9-10-28-20(12-15)21-13-22(30-29-21)24(25,26)27/h3-13H,1-2H3,(H,29,30).
What are the key properties of 4-(9,9-dimethylfluoren-2-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine?
4-(9,9-dimethylfluoren-2-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine has a molecular weight of 405.42 g/mol, XLogP of 6.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(9,9-dimethylfluoren-2-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine is sourced from PubChem (CID 126729682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).