About 1-[(2S,4S)-2-ethyloxan-4-yl]-1,3-dimethylurea
1-[(2S,4S)-2-ethyloxan-4-yl]-1,3-dimethylurea (PubChem CID 126729792) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-[(2S,4S)-2-ethyloxan-4-yl]-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-[(2S,4S)-2-ethyloxan-4-yl]-1,3-dimethylurea |
| PubChem CID | 126729792 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 1-[(2S,4S)-2-ethyloxan-4-yl]-1,3-dimethylurea |
| SMILES | CC[C@H]1C[C@@H](N(C)C(=O)NC)CCO1 |
| InChI | InChI=1S/C10H20N2O2/c1-4-9-7-8(5-6-14-9)12(3)10(13)11-2/h8-9H,4-7H2,1-3H3,(H,11,13)/t8-,9-/m0/s1 |
| InChIKey | TXNSICSCBZKBJK-IUCAKERBSA-N |
| XLogP | 1.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2S,4S)-2-ethyloxan-4-yl]-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,4S)-2-ethyloxan-4-yl]-1,3-dimethylurea?
The IUPAC name of 1-[(2S,4S)-2-ethyloxan-4-yl]-1,3-dimethylurea (CID 126729792) is 1-[(2S,4S)-2-ethyloxan-4-yl]-1,3-dimethylurea.
What is the SMILES notation for 1-[(2S,4S)-2-ethyloxan-4-yl]-1,3-dimethylurea?
The canonical SMILES for 1-[(2S,4S)-2-ethyloxan-4-yl]-1,3-dimethylurea is CC[C@H]1C[C@@H](N(C)C(=O)NC)CCO1.
What is the InChIKey of 1-[(2S,4S)-2-ethyloxan-4-yl]-1,3-dimethylurea?
The InChIKey is TXNSICSCBZKBJK-IUCAKERBSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-4-9-7-8(5-6-14-9)12(3)10(13)11-2/h8-9H,4-7H2,1-3H3,(H,11,13)/t8-,9-/m0/s1.
What are the key properties of 1-[(2S,4S)-2-ethyloxan-4-yl]-1,3-dimethylurea?
1-[(2S,4S)-2-ethyloxan-4-yl]-1,3-dimethylurea has a molecular weight of 200.28 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,4S)-2-ethyloxan-4-yl]-1,3-dimethylurea is sourced from PubChem (CID 126729792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).