C49H38N4 — CID 126730689
9-[4-(2,6-diphenylpyrimidin-4-yl)-3-methylphenyl]-N,N-bis(4-methylphenyl)carbazol-3-amine (PubChem CID 126730689) has the molecular formula C49H38N4 and a molecular weight of 682.87 g/mol. Its IUPAC name is 9-[4-(2,6-diphenylpyrimidin-4-yl)-3-methylphenyl]-N,N-bis(4-methylphenyl)carbazol-3-amine.
| Compound Name | 9-[4-(2,6-diphenylpyrimidin-4-yl)-3-methylphenyl]-N,N-bis(4-methylphenyl)carbazol-3-amine |
|---|---|
| PubChem CID | 126730689 |
| Molecular Formula | C49H38N4 |
| Molecular Weight | 682.87 g/mol |
| Exact Mass | 682.31 |
| IUPAC Name | 9-[4-(2,6-diphenylpyrimidin-4-yl)-3-methylphenyl]-N,N-bis(4-methylphenyl)carbazol-3-amine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc3c(c2)c2ccccc2n3-c2ccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)c(C)c2)cc1 |
| InChI | InChI=1S/C49H38N4/c1-33-18-22-38(23-19-33)52(39-24-20-34(2)21-25-39)41-27-29-48-44(31-41)43-16-10-11-17-47(43)53(48)40-26-28-42(35(3)30-40)46-32-45(36-12-6-4-7-13-36)50-49(51-46)37-14-8-5-9-15-37/h4-32H,1-3H3 |
| InChIKey | OZKSLPNCSVAQNU-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.87 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |