C57H37N9 — CID 126730884
2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 126730884) has the molecular formula C57H37N9 and a molecular weight of 847.99 g/mol. Its IUPAC name is 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 126730884 |
| Molecular Formula | C57H37N9 |
| Molecular Weight | 847.99 g/mol |
| Exact Mass | 847.32 |
| IUPAC Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cc(-c4ccc(-c5cc(-c6ccccn6)nc(-c6ccccn6)c5)cc4)cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)n2)cc1 |
| InChI | InChI=1S/C57H37N9/c1-5-17-40(18-6-1)52-61-53(41-19-7-2-8-20-41)64-56(63-52)46-33-44(34-47(35-46)57-65-54(42-21-9-3-10-22-42)62-55(66-57)43-23-11-4-12-24-43)38-27-29-39(30-28-38)45-36-50(48-25-13-15-31-58-48)60-51(37-45)49-26-14-16-32-59-49/h1-37H |
| InChIKey | PMORWYKNLCTOLN-UHFFFAOYSA-N |
| XLogP | 12.91 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.99 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |