About 5-fluoro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile
5-fluoro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile (PubChem CID 126731668) has the molecular formula C8H6FN3
and a molecular weight of 163.16 g/mol. Its IUPAC name is 5-fluoro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 5-fluoro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile |
| PubChem CID | 126731668 |
| Molecular Formula | C8H6FN3 |
| Molecular Weight | 163.16 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 5-fluoro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile |
| SMILES | N#CC1=C(F)CNc2[nH]ccc21 |
| InChI | InChI=1S/C8H6FN3/c9-7-4-12-8-5(1-2-11-8)6(7)3-10/h1-2,11-12H,4H2 |
| InChIKey | KKCJVAXZXBRMOU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.16 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile?
The IUPAC name of 5-fluoro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile (CID 126731668) is 5-fluoro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile.
What is the SMILES notation for 5-fluoro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile?
The canonical SMILES for 5-fluoro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile is N#CC1=C(F)CNc2[nH]ccc21.
What is the InChIKey of 5-fluoro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile?
The InChIKey is KKCJVAXZXBRMOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FN3/c9-7-4-12-8-5(1-2-11-8)6(7)3-10/h1-2,11-12H,4H2.
What are the key properties of 5-fluoro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile?
5-fluoro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile has a molecular weight of 163.16 g/mol, XLogP of 1.64, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile is sourced from PubChem (CID 126731668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).